C17H21N3O — CID 163773189
1-[(1S,2R)-4-(3-amino-4-pyridinyl)-2-methylcyclohexyl]pyridin-2-one (PubChem CID 163773189) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-[(1S,2R)-4-(3-amino-4-pyridinyl)-2-methylcyclohexyl]pyridin-2-one.
| Compound Name | 1-[(1S,2R)-4-(3-amino-4-pyridinyl)-2-methylcyclohexyl]pyridin-2-one |
|---|---|
| PubChem CID | 163773189 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-[(1S,2R)-4-(3-amino-4-pyridinyl)-2-methylcyclohexyl]pyridin-2-one |
| SMILES | C[C@@H]1CC(c2ccncc2N)CC[C@@H]1n1ccccc1=O |
| InChI | InChI=1S/C17H21N3O/c1-12-10-13(14-7-8-19-11-15(14)18)5-6-16(12)20-9-3-2-4-17(20)21/h2-4,7-9,11-13,16H,5-6,10,18H2,1H3/t12-,13?,16+/m1/s1 |
| InChIKey | MIEBGXVEISFDTJ-LRRQEPCHSA-N |
| XLogP | 2.97 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |