C33H31NO3 — CID 163773437
1-(7-benzoyl-9H-fluoren-2-yl)-2-benzyl-2-(2-hydroxyethylamino)butan-1-one (PubChem CID 163773437) has the molecular formula C33H31NO3 and a molecular weight of 489.62 g/mol. Its IUPAC name is 1-(7-benzoyl-9H-fluoren-2-yl)-2-benzyl-2-(2-hydroxyethylamino)butan-1-one.
| Compound Name | 1-(7-benzoyl-9H-fluoren-2-yl)-2-benzyl-2-(2-hydroxyethylamino)butan-1-one |
|---|---|
| PubChem CID | 163773437 |
| Molecular Formula | C33H31NO3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 1-(7-benzoyl-9H-fluoren-2-yl)-2-benzyl-2-(2-hydroxyethylamino)butan-1-one |
| SMILES | CCC(Cc1ccccc1)(NCCO)C(=O)c1ccc2c(c1)Cc1cc(C(=O)c3ccccc3)ccc1-2 |
| InChI | InChI=1S/C33H31NO3/c1-2-33(34-17-18-35,22-23-9-5-3-6-10-23)32(37)26-14-16-30-28(20-26)21-27-19-25(13-15-29(27)30)31(36)24-11-7-4-8-12-24/h3-16,19-20,34-35H,2,17-18,21-22H2,1H3 |
| InChIKey | MIJJSBYQYPFPGJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |