C16H18BrN3O — CID 163774945
6-bromo-3-methyl-2-piperidin-1-ylquinoline-4-carboxamide (PubChem CID 163774945) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is 6-bromo-3-methyl-2-piperidin-1-ylquinoline-4-carboxamide.
| Compound Name | 6-bromo-3-methyl-2-piperidin-1-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 163774945 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 6-bromo-3-methyl-2-piperidin-1-ylquinoline-4-carboxamide |
| SMILES | Cc1c(N2CCCCC2)nc2ccc(Br)cc2c1C(N)=O |
| InChI | InChI=1S/C16H18BrN3O/c1-10-14(15(18)21)12-9-11(17)5-6-13(12)19-16(10)20-7-3-2-4-8-20/h5-6,9H,2-4,7-8H2,1H3,(H2,18,21) |
| InChIKey | MJPFSUWLOWCXQO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |