C11H10ClIN- — CID 163775092
CID 163775092 (PubChem CID 163775092) has the molecular formula C11H10ClIN- and a molecular weight of 318.57 g/mol.
| Compound Name | CID 163775092 |
|---|---|
| PubChem CID | 163775092 |
| Molecular Formula | C11H10ClIN- |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 317.96 |
| IUPAC Name | — |
| SMILES | C=C1[I-]c2c(Cl)ccc3c2N1CCC3 |
| InChI | InChI=1S/C11H10ClIN/c1-7-13-10-9(12)5-4-8-3-2-6-14(7)11(8)10/h4-5H,1-3,6H2/q-1 |
| InChIKey | JYPCCWIEWXFPQE-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|