C10H10ClF2NS — CID 139601362
8-chloro-1-(difluoromethylsulfanyl)-3,4-dihydro-2H-quinoline (PubChem CID 139601362) has the molecular formula C10H10ClF2NS and a molecular weight of 249.71 g/mol. Its IUPAC name is 8-chloro-1-(difluoromethylsulfanyl)-3,4-dihydro-2H-quinoline.
| Compound Name | 8-chloro-1-(difluoromethylsulfanyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 139601362 |
| Molecular Formula | C10H10ClF2NS |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 8-chloro-1-(difluoromethylsulfanyl)-3,4-dihydro-2H-quinoline |
| SMILES | FC(F)SN1CCCc2cccc(Cl)c21 |
| InChI | InChI=1S/C10H10ClF2NS/c11-8-5-1-3-7-4-2-6-14(9(7)8)15-10(12)13/h1,3,5,10H,2,4,6H2 |
| InChIKey | ADUHMFAFLSRBIX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|