C15H21N5O5 — CID 163776222
2-amino-9-[(2R,5S)-5-(methoxymethyl)-3-prop-2-ynoxyoxolan-2-yl]-1H-purin-6-one;methanol (PubChem CID 163776222) has the molecular formula C15H21N5O5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-amino-9-[(2R,5S)-5-(methoxymethyl)-3-prop-2-ynoxyoxolan-2-yl]-1H-purin-6-one;methanol.
| Compound Name | 2-amino-9-[(2R,5S)-5-(methoxymethyl)-3-prop-2-ynoxyoxolan-2-yl]-1H-purin-6-one;methanol |
|---|---|
| PubChem CID | 163776222 |
| Molecular Formula | C15H21N5O5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-amino-9-[(2R,5S)-5-(methoxymethyl)-3-prop-2-ynoxyoxolan-2-yl]-1H-purin-6-one;methanol |
| SMILES | C#CCOC1C[C@@H](COC)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21.CO |
| InChI | InChI=1S/C14H17N5O4.CH4O/c1-3-4-22-9-5-8(6-21-2)23-13(9)19-7-16-10-11(19)17-14(15)18-12(10)20;1-2/h1,7-9,13H,4-6H2,2H3,(H3,15,17,18,20);2H,1H3/t8-,9?,13+;/m0./s1 |
| InChIKey | MKSBVVXBGOSFBJ-WYQDZTPLSA-N |
| XLogP | -0.74 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|