C9H16N3O4P — CID 163777674
2-amino-4-[3-methoxy-2-(phosphanylmethoxy)propoxy]-1H-pyrimidin-6-one (PubChem CID 163777674) has the molecular formula C9H16N3O4P and a molecular weight of 261.22 g/mol. Its IUPAC name is 2-amino-4-[3-methoxy-2-(phosphanylmethoxy)propoxy]-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[3-methoxy-2-(phosphanylmethoxy)propoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 163777674 |
| Molecular Formula | C9H16N3O4P |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-amino-4-[3-methoxy-2-(phosphanylmethoxy)propoxy]-1H-pyrimidin-6-one |
| SMILES | COCC(COc1cc(=O)[nH]c(N)n1)OCP |
| InChI | InChI=1S/C9H16N3O4P/c1-14-3-6(16-5-17)4-15-8-2-7(13)11-9(10)12-8/h2,6H,3-5,17H2,1H3,(H3,10,11,12,13) |
| InChIKey | MLWQNSDVKWZXGX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|