About 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one
2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one (PubChem CID 141061279) has the molecular formula C7H8N3O4P
and a molecular weight of 229.13 g/mol. Its IUPAC name is 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one |
| PubChem CID | 141061279 |
| Molecular Formula | C7H8N3O4P |
| Molecular Weight | 229.13 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one |
| SMILES | Nc1nc(OCCOC#P=O)cc(=O)[nH]1 |
| InChI | InChI=1S/C7H8N3O4P/c8-7-9-5(11)3-6(10-7)14-2-1-13-4-15-12/h3H,1-2H2,(H3,8,9,10,11) |
| InChIKey | BFAOYOSHAPGXSM-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.13 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one?
The IUPAC name of 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one (CID 141061279) is 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one.
What is the SMILES notation for 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one?
The canonical SMILES for 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one is Nc1nc(OCCOC#P=O)cc(=O)[nH]1.
What is the InChIKey of 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one?
The InChIKey is BFAOYOSHAPGXSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N3O4P/c8-7-9-5(11)3-6(10-7)14-2-1-13-4-15-12/h3H,1-2H2,(H3,8,9,10,11).
What are the key properties of 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one?
2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one has a molecular weight of 229.13 g/mol, XLogP of -0.04, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[2-[(oxo-λ5-phosphanylidyne)methoxy]ethoxy]-1H-pyrimidin-6-one is sourced from PubChem (CID 141061279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).