C13H24N3O4P — CID 141061269
2-amino-4-[2-[di(propan-2-yl)phosphorylmethoxy]ethoxy]-1H-pyrimidin-6-one (PubChem CID 141061269) has the molecular formula C13H24N3O4P and a molecular weight of 317.33 g/mol. Its IUPAC name is 2-amino-4-[2-[di(propan-2-yl)phosphorylmethoxy]ethoxy]-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-[2-[di(propan-2-yl)phosphorylmethoxy]ethoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 141061269 |
| Molecular Formula | C13H24N3O4P |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-amino-4-[2-[di(propan-2-yl)phosphorylmethoxy]ethoxy]-1H-pyrimidin-6-one |
| SMILES | CC(C)P(=O)(COCCOc1cc(=O)[nH]c(N)n1)C(C)C |
| InChI | InChI=1S/C13H24N3O4P/c1-9(2)21(18,10(3)4)8-19-5-6-20-12-7-11(17)15-13(14)16-12/h7,9-10H,5-6,8H2,1-4H3,(H3,14,15,16,17) |
| InChIKey | VDQJVMCFZAGSJA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|