C46H50BClN2O2 — CID 163779493
6-chloro-1-(3,5-dimethylphenyl)isoquinoline;1-(3,5-dimethylphenyl)-6-prop-1-en-2-ylisoquinoline;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane (PubChem CID 163779493) has the molecular formula C46H50BClN2O2 and a molecular weight of 709.18 g/mol. Its IUPAC name is 6-chloro-1-(3,5-dimethylphenyl)isoquinoline;1-(3,5-dimethylphenyl)-6-prop-1-en-2-ylisoquinoline;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane.
| Compound Name | 6-chloro-1-(3,5-dimethylphenyl)isoquinoline;1-(3,5-dimethylphenyl)-6-prop-1-en-2-ylisoquinoline;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163779493 |
| Molecular Formula | C46H50BClN2O2 |
| Molecular Weight | 709.18 g/mol |
| Exact Mass | 708.37 |
| IUPAC Name | 6-chloro-1-(3,5-dimethylphenyl)isoquinoline;1-(3,5-dimethylphenyl)-6-prop-1-en-2-ylisoquinoline;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane |
| SMILES | C=C(C)B1OC(C)(C)C(C)(C)O1.C=C(C)c1ccc2c(-c3cc(C)cc(C)c3)nccc2c1.Cc1cc(C)cc(-c2nccc3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C20H19N.C17H14ClN.C9H17BO2/c1-13(2)16-5-6-19-17(12-16)7-8-21-20(19)18-10-14(3)9-15(4)11-18;1-11-7-12(2)9-14(8-11)17-16-4-3-15(18)10-13(16)5-6-19-17;1-7(2)10-11-8(3,4)9(5,6)12-10/h5-12H,1H2,2-4H3;3-10H,1-2H3;1H2,2-6H3 |
| InChIKey | MNKWTDFGVKMBKU-UHFFFAOYSA-N |
| XLogP | 12.92 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.18 |
| LogP ≤ 5 | 12.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|