C20H23NO3 — CID 163782378
pentan-2-yl (Z)-3-(5-phenylmethoxy-2-pyridinyl)prop-2-enoate (PubChem CID 163782378) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is pentan-2-yl (Z)-3-(5-phenylmethoxy-2-pyridinyl)prop-2-enoate.
| Compound Name | pentan-2-yl (Z)-3-(5-phenylmethoxy-2-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 163782378 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | pentan-2-yl (Z)-3-(5-phenylmethoxy-2-pyridinyl)prop-2-enoate |
| SMILES | CCCC(C)OC(=O)/C=C\c1ccc(OCc2ccccc2)cn1 |
| InChI | InChI=1S/C20H23NO3/c1-3-7-16(2)24-20(22)13-11-18-10-12-19(14-21-18)23-15-17-8-5-4-6-9-17/h4-6,8-14,16H,3,7,15H2,1-2H3/b13-11- |
| InChIKey | MPQNKLSPKPJFES-QBFSEMIESA-N |
| XLogP | 4.41 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|