C14H30N2 — CID 163782424
1-butyl-2-hexyl-1,3-diazinane (PubChem CID 163782424) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1-butyl-2-hexyl-1,3-diazinane.
| Compound Name | 1-butyl-2-hexyl-1,3-diazinane |
|---|---|
| PubChem CID | 163782424 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1-butyl-2-hexyl-1,3-diazinane |
| SMILES | CCCCCCC1NCCCN1CCCC |
| InChI | InChI=1S/C14H30N2/c1-3-5-7-8-10-14-15-11-9-13-16(14)12-6-4-2/h14-15H,3-13H2,1-2H3 |
| InChIKey | MPRQZDBUQRIOLT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|