C11H22N2O2S — CID 117005469
5-butyl-1,2,3,4,5a,6,8,8a-octahydrothieno[3,4-b][1,4]diazepine 7,7-dioxide (PubChem CID 117005469) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 5-butyl-1,2,3,4,5a,6,8,8a-octahydrothieno[3,4-b][1,4]diazepine 7,7-dioxide.
| Compound Name | 5-butyl-1,2,3,4,5a,6,8,8a-octahydrothieno[3,4-b][1,4]diazepine 7,7-dioxide |
|---|---|
| PubChem CID | 117005469 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-butyl-1,2,3,4,5a,6,8,8a-octahydrothieno[3,4-b][1,4]diazepine 7,7-dioxide |
| SMILES | CCCCN1CCCNC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C11H22N2O2S/c1-2-3-6-13-7-4-5-12-10-8-16(14,15)9-11(10)13/h10-12H,2-9H2,1H3 |
| InChIKey | WKBUXXZYOYJLMH-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |