C13H25NO — CID 22828499
(4aS,7S,8aS)-1-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-7-ol (PubChem CID 22828499) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (4aS,7S,8aS)-1-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-7-ol.
| Compound Name | (4aS,7S,8aS)-1-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-7-ol |
|---|---|
| PubChem CID | 22828499 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (4aS,7S,8aS)-1-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-7-ol |
| SMILES | CCCCN1CCC[C@H]2CC[C@H](O)C[C@@H]21 |
| InChI | InChI=1S/C13H25NO/c1-2-3-8-14-9-4-5-11-6-7-12(15)10-13(11)14/h11-13,15H,2-10H2,1H3/t11-,12-,13-/m0/s1 |
| InChIKey | IQWCNIATYLFDKW-AVGNSLFASA-N |
| XLogP | 2.41 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |