C16H24NO7S+ — CID 163782907
[(1R,4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-4-(2-methylsulfonyloxyethyl)-3-oxo-6-oxa-2-azabicyclo[3.2.0]heptan-7-ylidene]oxidanium (PubChem CID 163782907) has the molecular formula C16H24NO7S+ and a molecular weight of 374.44 g/mol. Its IUPAC name is [(1R,4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-4-(2-methylsulfonyloxyethyl)-3-oxo-6-oxa-2-azabicyclo[3.2.0]heptan-7-ylidene]oxidanium.
| Compound Name | [(1R,4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-4-(2-methylsulfonyloxyethyl)-3-oxo-6-oxa-2-azabicyclo[3.2.0]heptan-7-ylidene]oxidanium |
|---|---|
| PubChem CID | 163782907 |
| Molecular Formula | C16H24NO7S+ |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [(1R,4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-5-methyl-4-(2-methylsulfonyloxyethyl)-3-oxo-6-oxa-2-azabicyclo[3.2.0]heptan-7-ylidene]oxidanium |
| SMILES | [H]/[O+]=C1\O[C@@]2(C)[C@@H](CCOS(C)(=O)=O)C(=O)N[C@@]12[C@@H](O)[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C16H23NO7S/c1-15-11(8-9-23-25(2,21)22)13(19)17-16(15,14(20)24-15)12(18)10-6-4-3-5-7-10/h4,6,10-12,18H,3,5,7-9H2,1-2H3,(H,17,19)/p+1/t10-,11+,12+,15+,16+/m1/s1 |
| InChIKey | MQCNYMXBTARDON-BFPXCNAZSA-O |
| XLogP | -0.15 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|