C17H26N2OU — CID 163783016
carbanide;1-[(3-methoxy-4-methylbenzene-2-id-1-yl)methyl]-4-prop-2-enylpiperazine;uranium(2+) (PubChem CID 163783016) has the molecular formula C17H26N2OU and a molecular weight of 512.44 g/mol. Its IUPAC name is carbanide;1-[(3-methoxy-4-methylbenzene-2-id-1-yl)methyl]-4-prop-2-enylpiperazine;uranium(2+).
| Compound Name | carbanide;1-[(3-methoxy-4-methylbenzene-2-id-1-yl)methyl]-4-prop-2-enylpiperazine;uranium(2+) |
|---|---|
| PubChem CID | 163783016 |
| Molecular Formula | C17H26N2OU |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | carbanide;1-[(3-methoxy-4-methylbenzene-2-id-1-yl)methyl]-4-prop-2-enylpiperazine;uranium(2+) |
| SMILES | C=CCN1CCN(Cc2[c-]c(OC)c(C)cc2)CC1.[CH3-].[U+2] |
| InChI | InChI=1S/C16H23N2O.CH3.U/c1-4-7-17-8-10-18(11-9-17)13-15-6-5-14(2)16(12-15)19-3;;/h4-6H,1,7-11,13H2,2-3H3;1H3;/q2*-1;+2 |
| InChIKey | DXDPJEXCGHKWRU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|