C18H32N2O — CID 142256401
but-1-ene;1-(3-methoxycyclohexa-2,4-dien-1-yl)-4-propylpiperazine (PubChem CID 142256401) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is but-1-ene;1-(3-methoxycyclohexa-2,4-dien-1-yl)-4-propylpiperazine.
| Compound Name | but-1-ene;1-(3-methoxycyclohexa-2,4-dien-1-yl)-4-propylpiperazine |
|---|---|
| PubChem CID | 142256401 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | but-1-ene;1-(3-methoxycyclohexa-2,4-dien-1-yl)-4-propylpiperazine |
| SMILES | C=CCC.CCCN1CCN(C2C=C(OC)C=CC2)CC1 |
| InChI | InChI=1S/C14H24N2O.C4H8/c1-3-7-15-8-10-16(11-9-15)13-5-4-6-14(12-13)17-2;1-3-4-2/h4,6,12-13H,3,5,7-11H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | RYNWGERJUHLQGS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|