C24H23ClFN3O2 — CID 163786051
N-[6-(1-benzylpiperidin-4-yl)oxy-2-pyridinyl]-2-chloro-4-fluorobenzamide (PubChem CID 163786051) has the molecular formula C24H23ClFN3O2 and a molecular weight of 439.92 g/mol. Its IUPAC name is N-[6-(1-benzylpiperidin-4-yl)oxy-2-pyridinyl]-2-chloro-4-fluorobenzamide.
| Compound Name | N-[6-(1-benzylpiperidin-4-yl)oxy-2-pyridinyl]-2-chloro-4-fluorobenzamide |
|---|---|
| PubChem CID | 163786051 |
| Molecular Formula | C24H23ClFN3O2 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | N-[6-(1-benzylpiperidin-4-yl)oxy-2-pyridinyl]-2-chloro-4-fluorobenzamide |
| SMILES | O=C(Nc1cccc(OC2CCN(Cc3ccccc3)CC2)n1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C24H23ClFN3O2/c25-21-15-18(26)9-10-20(21)24(30)28-22-7-4-8-23(27-22)31-19-11-13-29(14-12-19)16-17-5-2-1-3-6-17/h1-10,15,19H,11-14,16H2,(H,27,28,30) |
| InChIKey | MSQHSNGVDOTQJT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |