C18H19BFN3O2 — CID 88581631
CID 88581631 (PubChem CID 88581631) has the molecular formula C18H19BFN3O2 and a molecular weight of 339.18 g/mol.
| Compound Name | CID 88581631 |
|---|---|
| PubChem CID | 88581631 |
| Molecular Formula | C18H19BFN3O2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)ccc1C(=O)Nc1cccc(OC2CCN(C)CC2)n1 |
| InChI | InChI=1S/C18H19BFN3O2/c1-23-9-7-13(8-10-23)25-17-4-2-3-16(21-17)22-18(24)14-6-5-12(20)11-15(14)19/h2-6,11,13H,7-10H2,1H3,(H,21,22,24) |
| InChIKey | BBYIWDYNRKAINR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|