C18H19F3N4O — CID 58997284
2,3,4-trifluoro-N-[6-[(1-methylpiperidin-4-yl)amino]-2-pyridinyl]benzamide (PubChem CID 58997284) has the molecular formula C18H19F3N4O and a molecular weight of 364.37 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[6-[(1-methylpiperidin-4-yl)amino]-2-pyridinyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[6-[(1-methylpiperidin-4-yl)amino]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 58997284 |
| Molecular Formula | C18H19F3N4O |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2,3,4-trifluoro-N-[6-[(1-methylpiperidin-4-yl)amino]-2-pyridinyl]benzamide |
| SMILES | CN1CCC(Nc2cccc(NC(=O)c3ccc(F)c(F)c3F)n2)CC1 |
| InChI | InChI=1S/C18H19F3N4O/c1-25-9-7-11(8-10-25)22-14-3-2-4-15(23-14)24-18(26)12-5-6-13(19)17(21)16(12)20/h2-6,11H,7-10H2,1H3,(H2,22,23,24,26) |
| InChIKey | PJYOGAZXDFTIBY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|