C19H24N4OPSi — CID 70639140
CID 70639140 (PubChem CID 70639140) has the molecular formula C19H24N4OPSi and a molecular weight of 383.49 g/mol.
| Compound Name | CID 70639140 |
|---|---|
| PubChem CID | 70639140 |
| Molecular Formula | C19H24N4OPSi |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | — |
| SMILES | CCN1CCC(Nc2cccc(NC(=O)c3ccc(P)cc3[Si])n2)CC1 |
| InChI | InChI=1S/C19H24N4OPSi/c1-2-23-10-8-13(9-11-23)20-17-4-3-5-18(21-17)22-19(24)15-7-6-14(25)12-16(15)26/h3-7,12-13H,2,8-11,25H2,1H3,(H2,20,21,22,24) |
| InChIKey | WOPKXKRHTFZCHY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|