About 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine
2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine (PubChem CID 163787100) has the molecular formula C20H28N6O2
and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine.
Molecular Properties
| Compound Name | 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine |
| PubChem CID | 163787100 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine |
| SMILES | COCCC1N=c2nc(Nc3cccc(C)c3)[nH]c2=C(N2CCOCC2)N1C |
| InChI | InChI=1S/C20H28N6O2/c1-14-5-4-6-15(13-14)21-20-23-17-18(24-20)22-16(7-10-27-3)25(2)19(17)26-8-11-28-12-9-26/h4-6,13,16H,7-12H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | MTMHIYYYDGFZOH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine?
The IUPAC name of 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine (CID 163787100) is 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine.
What is the SMILES notation for 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine?
The canonical SMILES for 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine is COCCC1N=c2nc(Nc3cccc(C)c3)[nH]c2=C(N2CCOCC2)N1C.
What is the InChIKey of 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine?
The InChIKey is MTMHIYYYDGFZOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28N6O2/c1-14-5-4-6-15(13-14)21-20-23-17-18(24-20)22-16(7-10-27-3)25(2)19(17)26-8-11-28-12-9-26/h4-6,13,16H,7-12H2,1-3H3,(H2,21,22,23,24).
What are the key properties of 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine?
2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine has a molecular weight of 384.48 g/mol, XLogP of 0.79, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethyl)-1-methyl-N-(3-methylphenyl)-6-morpholin-4-yl-2,7-dihydropurin-8-amine is sourced from PubChem (CID 163787100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).