C23H26N8O3 — CID 142981790
1-[[8-(3-methylanilino)-6-morpholin-4-yl-7H-purin-2-yl]amino]-2-pyridin-3-yloxyethanol (PubChem CID 142981790) has the molecular formula C23H26N8O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is 1-[[8-(3-methylanilino)-6-morpholin-4-yl-7H-purin-2-yl]amino]-2-pyridin-3-yloxyethanol.
| Compound Name | 1-[[8-(3-methylanilino)-6-morpholin-4-yl-7H-purin-2-yl]amino]-2-pyridin-3-yloxyethanol |
|---|---|
| PubChem CID | 142981790 |
| Molecular Formula | C23H26N8O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 1-[[8-(3-methylanilino)-6-morpholin-4-yl-7H-purin-2-yl]amino]-2-pyridin-3-yloxyethanol |
| SMILES | Cc1cccc(Nc2nc3nc(NC(O)COc4cccnc4)nc(N4CCOCC4)c3[nH]2)c1 |
| InChI | InChI=1S/C23H26N8O3/c1-15-4-2-5-16(12-15)25-22-27-19-20(28-22)29-23(30-21(19)31-8-10-33-11-9-31)26-18(32)14-34-17-6-3-7-24-13-17/h2-7,12-13,18,32H,8-11,14H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | OVNHWKMHJALMJF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 133.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|