C24H28N8OS — CID 59769696
S-[4-[2-[[8-(3-methylanilino)-6-morpholin-4-yl-7H-purin-2-yl]amino]ethyl]phenyl]thiohydroxylamine (PubChem CID 59769696) has the molecular formula C24H28N8OS and a molecular weight of 476.61 g/mol. Its IUPAC name is S-[4-[2-[[8-(3-methylanilino)-6-morpholin-4-yl-7H-purin-2-yl]amino]ethyl]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[2-[[8-(3-methylanilino)-6-morpholin-4-yl-7H-purin-2-yl]amino]ethyl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 59769696 |
| Molecular Formula | C24H28N8OS |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | S-[4-[2-[[8-(3-methylanilino)-6-morpholin-4-yl-7H-purin-2-yl]amino]ethyl]phenyl]thiohydroxylamine |
| SMILES | Cc1cccc(Nc2nc3nc(NCCc4ccc(SN)cc4)nc(N4CCOCC4)c3[nH]2)c1 |
| InChI | InChI=1S/C24H28N8OS/c1-16-3-2-4-18(15-16)27-24-28-20-21(30-24)29-23(31-22(20)32-11-13-33-14-12-32)26-10-9-17-5-7-19(34-25)8-6-17/h2-8,15H,9-14,25H2,1H3,(H3,26,27,28,29,30,31) |
| InChIKey | VTXYTYLQRIODPY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|