C32H26N3O5-3 — CID 163787963
1-N-methyl-4-N-[4-[4-[4-(4-methylphenoxy)-N-oxidoanilino]phenoxy]phenyl]-1-N,4-N-dioxidobenzene-1,4-diamine (PubChem CID 163787963) has the molecular formula C32H26N3O5-3 and a molecular weight of 532.58 g/mol. Its IUPAC name is 1-N-methyl-4-N-[4-[4-[4-(4-methylphenoxy)-N-oxidoanilino]phenoxy]phenyl]-1-N,4-N-dioxidobenzene-1,4-diamine.
| Compound Name | 1-N-methyl-4-N-[4-[4-[4-(4-methylphenoxy)-N-oxidoanilino]phenoxy]phenyl]-1-N,4-N-dioxidobenzene-1,4-diamine |
|---|---|
| PubChem CID | 163787963 |
| Molecular Formula | C32H26N3O5-3 |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 1-N-methyl-4-N-[4-[4-[4-(4-methylphenoxy)-N-oxidoanilino]phenoxy]phenyl]-1-N,4-N-dioxidobenzene-1,4-diamine |
| SMILES | Cc1ccc(Oc2ccc(N([O-])c3ccc(Oc4ccc(N([O-])c5ccc(N(C)[O-])cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H26N3O5/c1-23-3-15-29(16-4-23)39-30-17-11-27(12-18-30)35(38)28-13-21-32(22-14-28)40-31-19-9-26(10-20-31)34(37)25-7-5-24(6-8-25)33(2)36/h3-22H,1-2H3/q-3 |
| InChIKey | KRDAFCVYNGICHF-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|