C20H18N2O2-2 — CID 163779490
4-N-(3-methylphenyl)-1-N-(4-methylphenyl)-1-N,4-N-dioxidobenzene-1,4-diamine (PubChem CID 163779490) has the molecular formula C20H18N2O2-2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-N-(3-methylphenyl)-1-N-(4-methylphenyl)-1-N,4-N-dioxidobenzene-1,4-diamine.
| Compound Name | 4-N-(3-methylphenyl)-1-N-(4-methylphenyl)-1-N,4-N-dioxidobenzene-1,4-diamine |
|---|---|
| PubChem CID | 163779490 |
| Molecular Formula | C20H18N2O2-2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-N-(3-methylphenyl)-1-N-(4-methylphenyl)-1-N,4-N-dioxidobenzene-1,4-diamine |
| SMILES | Cc1ccc(N([O-])c2ccc(N([O-])c3cccc(C)c3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O2/c1-15-6-8-17(9-7-15)21(23)18-10-12-19(13-11-18)22(24)20-5-3-4-16(2)14-20/h3-14H,1-2H3/q-2 |
| InChIKey | RLIPGLQQFAATLX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|