C55H42N4OSi — CID 163789166
[3-(7,10-dimethylbenzimidazolo[2,1-b][1,3]benzoxazol-9-yl)phenyl]-[3-[6-methyl-9-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazol-7-yl]phenyl]-diphenylsilane (PubChem CID 163789166) has the molecular formula C55H42N4OSi and a molecular weight of 806.07 g/mol. Its IUPAC name is [3-(7,10-dimethylbenzimidazolo[2,1-b][1,3]benzoxazol-9-yl)phenyl]-[3-[6-methyl-9-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazol-7-yl]phenyl]-diphenylsilane.
| Compound Name | [3-(7,10-dimethylbenzimidazolo[2,1-b][1,3]benzoxazol-9-yl)phenyl]-[3-[6-methyl-9-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazol-7-yl]phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 163789166 |
| Molecular Formula | C55H42N4OSi |
| Molecular Weight | 806.07 g/mol |
| Exact Mass | 805.33 |
| IUPAC Name | [3-(7,10-dimethylbenzimidazolo[2,1-b][1,3]benzoxazol-9-yl)phenyl]-[3-[6-methyl-9-(trideuteriomethyl)-11H-indolo[1,2-a]benzimidazol-7-yl]phenyl]-diphenylsilane |
| SMILES | [2H]C([2H])([2H])c1cc(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3cccc(-c4cc(C)c5nc6oc7ccccc7n6c5c4C)c3)c2)c(C)c2c1nc1n2-c2ccccc2C1 |
| InChI | InChI=1S/C55H42N4OSi/c1-34-29-45(36(3)53-51(34)56-50-33-40-17-11-12-26-47(40)58(50)53)38-18-15-24-43(31-38)61(41-20-7-5-8-21-41,42-22-9-6-10-23-42)44-25-16-19-39(32-44)46-30-35(2)52-54(37(46)4)59-48-27-13-14-28-49(48)60-55(59)57-52/h5-32H,33H2,1-4H3/i1D3 |
| InChIKey | FQFKNDFRDWHSOI-FIBGUPNXSA-N |
| XLogP | 10.42 |
| TPSA | 48.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.07 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|