C15H23NO3S — CID 163789190
methyl 1-[[(2E,4Z)-2-methyl-5-sulfanylhexa-2,4-dienoyl]amino]cyclohexane-1-carboxylate (PubChem CID 163789190) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is methyl 1-[[(2E,4Z)-2-methyl-5-sulfanylhexa-2,4-dienoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[(2E,4Z)-2-methyl-5-sulfanylhexa-2,4-dienoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163789190 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | methyl 1-[[(2E,4Z)-2-methyl-5-sulfanylhexa-2,4-dienoyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)/C(C)=C/C=C(/C)S)CCCCC1 |
| InChI | InChI=1S/C15H23NO3S/c1-11(7-8-12(2)20)13(17)16-15(14(18)19-3)9-5-4-6-10-15/h7-8,20H,4-6,9-10H2,1-3H3,(H,16,17)/b11-7+,12-8- |
| InChIKey | MVFHGGVPPPDHTR-RLCSYUECSA-N |
| XLogP | 2.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|