C16H20O6 — CID 163789288
methyl 2-[(1aR,3S,3aR,5S,7aR,7bR)-3-hydroxy-3,7a-dimethyl-2,4-dioxo-1a,3a,5,6,7,7b-hexahydronaphtho[1,2-b]oxiren-5-yl]prop-2-enoate (PubChem CID 163789288) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl 2-[(1aR,3S,3aR,5S,7aR,7bR)-3-hydroxy-3,7a-dimethyl-2,4-dioxo-1a,3a,5,6,7,7b-hexahydronaphtho[1,2-b]oxiren-5-yl]prop-2-enoate.
| Compound Name | methyl 2-[(1aR,3S,3aR,5S,7aR,7bR)-3-hydroxy-3,7a-dimethyl-2,4-dioxo-1a,3a,5,6,7,7b-hexahydronaphtho[1,2-b]oxiren-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 163789288 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | methyl 2-[(1aR,3S,3aR,5S,7aR,7bR)-3-hydroxy-3,7a-dimethyl-2,4-dioxo-1a,3a,5,6,7,7b-hexahydronaphtho[1,2-b]oxiren-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@]2(C)[C@@H](C1=O)[C@](C)(O)C(=O)[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C16H20O6/c1-7(14(19)21-4)8-5-6-15(2)11(9(8)17)16(3,20)12(18)10-13(15)22-10/h8,10-11,13,20H,1,5-6H2,2-4H3/t8-,10-,11+,13-,15+,16-/m0/s1 |
| InChIKey | MVHJWSZNKSGXCX-ZQAXNYRKSA-N |
| XLogP | 0.42 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|