C14H22N2O2S — CID 163791167
tert-butyl N-[(5aR,9aS)-4,5,5a,6,9,9a-hexahydro-3,1-benzothiazepin-5-yl]carbamate (PubChem CID 163791167) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is tert-butyl N-[(5aR,9aS)-4,5,5a,6,9,9a-hexahydro-3,1-benzothiazepin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5aR,9aS)-4,5,5a,6,9,9a-hexahydro-3,1-benzothiazepin-5-yl]carbamate |
|---|---|
| PubChem CID | 163791167 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | tert-butyl N-[(5aR,9aS)-4,5,5a,6,9,9a-hexahydro-3,1-benzothiazepin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CSC=N[C@H]2CC=CC[C@H]12 |
| InChI | InChI=1S/C14H22N2O2S/c1-14(2,3)18-13(17)16-12-8-19-9-15-11-7-5-4-6-10(11)12/h4-5,9-12H,6-8H2,1-3H3,(H,16,17)/t10-,11-,12?/m0/s1 |
| InChIKey | MWWDBISQEKJESY-NDQFZYFBSA-N |
| XLogP | 2.99 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|