C9H12FN — CID 163791182
(6R)-5-fluoro-6-methyl-2,3,6,7-tetrahydro-1H-indole (PubChem CID 163791182) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is (6R)-5-fluoro-6-methyl-2,3,6,7-tetrahydro-1H-indole.
| Compound Name | (6R)-5-fluoro-6-methyl-2,3,6,7-tetrahydro-1H-indole |
|---|---|
| PubChem CID | 163791182 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | (6R)-5-fluoro-6-methyl-2,3,6,7-tetrahydro-1H-indole |
| SMILES | C[C@@H]1CC2=C(C=C1F)CCN2 |
| InChI | InChI=1S/C9H12FN/c1-6-4-9-7(2-3-11-9)5-8(6)10/h5-6,11H,2-4H2,1H3/t6-/m1/s1 |
| InChIKey | MWWLSOYIZINROM-ZCFIWIBFSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |