C18H21FN2 — CID 163792939
2-cyclopropyl-4-[(1E)-1-(3-fluorocyclohex-3-en-1-ylidene)ethyl]-3a,4-dihydro-1H-benzimidazole (PubChem CID 163792939) has the molecular formula C18H21FN2 and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-cyclopropyl-4-[(1E)-1-(3-fluorocyclohex-3-en-1-ylidene)ethyl]-3a,4-dihydro-1H-benzimidazole.
| Compound Name | 2-cyclopropyl-4-[(1E)-1-(3-fluorocyclohex-3-en-1-ylidene)ethyl]-3a,4-dihydro-1H-benzimidazole |
|---|---|
| PubChem CID | 163792939 |
| Molecular Formula | C18H21FN2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-cyclopropyl-4-[(1E)-1-(3-fluorocyclohex-3-en-1-ylidene)ethyl]-3a,4-dihydro-1H-benzimidazole |
| SMILES | C/C(=C1/CCC=C(F)C1)C1C=CC=C2NC(C3CC3)=NC21 |
| InChI | InChI=1S/C18H21FN2/c1-11(13-4-2-5-14(19)10-13)15-6-3-7-16-17(15)21-18(20-16)12-8-9-12/h3,5-7,12,15,17H,2,4,8-10H2,1H3,(H,20,21)/b13-11+ |
| InChIKey | MYJOLPRCMBROHY-ACCUITESSA-N |
| XLogP | 4.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|