C21H22ClN4O3- — CID 163798895
N-[4-[5-(2-chlorophenyl)-4-[[oxido(propan-2-yl)amino]methyl]-1,3-oxazol-2-yl]-5-methyl-2-pyridinyl]acetamide (PubChem CID 163798895) has the molecular formula C21H22ClN4O3- and a molecular weight of 413.89 g/mol. Its IUPAC name is N-[4-[5-(2-chlorophenyl)-4-[[oxido(propan-2-yl)amino]methyl]-1,3-oxazol-2-yl]-5-methyl-2-pyridinyl]acetamide.
| Compound Name | N-[4-[5-(2-chlorophenyl)-4-[[oxido(propan-2-yl)amino]methyl]-1,3-oxazol-2-yl]-5-methyl-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 163798895 |
| Molecular Formula | C21H22ClN4O3- |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[4-[5-(2-chlorophenyl)-4-[[oxido(propan-2-yl)amino]methyl]-1,3-oxazol-2-yl]-5-methyl-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2nc(CN([O-])C(C)C)c(-c3ccccc3Cl)o2)c(C)cn1 |
| InChI | InChI=1S/C21H22ClN4O3/c1-12(2)26(28)11-18-20(15-7-5-6-8-17(15)22)29-21(25-18)16-9-19(24-14(4)27)23-10-13(16)3/h5-10,12H,11H2,1-4H3,(H,23,24,27)/q-1 |
| InChIKey | NGLZYHVHVIJGKR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|