C21H21ClN4O4 — CID 67776016
2-(2-acetamido-5-methyl-4-pyridinyl)-5-(2-chlorophenyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide (PubChem CID 67776016) has the molecular formula C21H21ClN4O4 and a molecular weight of 428.88 g/mol. Its IUPAC name is 2-(2-acetamido-5-methyl-4-pyridinyl)-5-(2-chlorophenyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(2-acetamido-5-methyl-4-pyridinyl)-5-(2-chlorophenyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 67776016 |
| Molecular Formula | C21H21ClN4O4 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-(2-acetamido-5-methyl-4-pyridinyl)-5-(2-chlorophenyl)-N-(2-methoxyethyl)-1,3-oxazole-4-carboxamide |
| SMILES | COCCNC(=O)c1nc(-c2cc(NC(C)=O)ncc2C)oc1-c1ccccc1Cl |
| InChI | InChI=1S/C21H21ClN4O4/c1-12-11-24-17(25-13(2)27)10-15(12)21-26-18(20(28)23-8-9-29-3)19(30-21)14-6-4-5-7-16(14)22/h4-7,10-11H,8-9H2,1-3H3,(H,23,28)(H,24,25,27) |
| InChIKey | JIDCGXNUZVSHQY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|