C27H34N8O4S — CID 163802509
N-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(3-amino-4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-2-(methylamino)-N-propan-2-ylacetamide (PubChem CID 163802509) has the molecular formula C27H34N8O4S and a molecular weight of 566.69 g/mol. Its IUPAC name is N-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(3-amino-4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-2-(methylamino)-N-propan-2-ylacetamide.
| Compound Name | N-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(3-amino-4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-2-(methylamino)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 163802509 |
| Molecular Formula | C27H34N8O4S |
| Molecular Weight | 566.69 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | N-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-[(3-amino-4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-2-(methylamino)-N-propan-2-ylacetamide |
| SMILES | CNCC(=O)N(C(C)C)N1CC(=O)N2[C@@H](Cc3ccc(O)c(N)c3)C(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C27H34N8O4S/c1-15(2)35(23(37)11-30-3)33-14-24(38)34-19(10-16-7-8-20(36)18(28)9-16)26(39)32(13-22(33)34)12-17-5-4-6-21-25(17)31-27(29)40-21/h4-9,15,19,22,30,36H,10-14,28H2,1-3H3,(H2,29,31)/t19-,22+/m0/s1 |
| InChIKey | NGFJVJBBEVLPKJ-SIKLNZKXSA-N |
| XLogP | 0.96 |
| TPSA | 161.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.69 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|