C14H25N2O4P — CID 163802590
6-hydroxy-5-methyl-3-(4-prop-2-enoxyphosphanyloxyhexan-2-yl)-1,6-dihydropyrimidin-2-one (PubChem CID 163802590) has the molecular formula C14H25N2O4P and a molecular weight of 316.34 g/mol. Its IUPAC name is 6-hydroxy-5-methyl-3-(4-prop-2-enoxyphosphanyloxyhexan-2-yl)-1,6-dihydropyrimidin-2-one.
| Compound Name | 6-hydroxy-5-methyl-3-(4-prop-2-enoxyphosphanyloxyhexan-2-yl)-1,6-dihydropyrimidin-2-one |
|---|---|
| PubChem CID | 163802590 |
| Molecular Formula | C14H25N2O4P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 6-hydroxy-5-methyl-3-(4-prop-2-enoxyphosphanyloxyhexan-2-yl)-1,6-dihydropyrimidin-2-one |
| SMILES | C=CCOPOC(CC)CC(C)N1C=C(C)C(O)NC1=O |
| InChI | InChI=1S/C14H25N2O4P/c1-5-7-19-21-20-12(6-2)8-11(4)16-9-10(3)13(17)15-14(16)18/h5,9,11-13,17,21H,1,6-8H2,2-4H3,(H,15,18) |
| InChIKey | NGHAMMLXEAZBCM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|