C26H26N2O6 — CID 118176349
2-(5,7,12,14-tetraoxo-13-pentan-3-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)butyl prop-2-enoate (PubChem CID 118176349) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-(5,7,12,14-tetraoxo-13-pentan-3-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)butyl prop-2-enoate.
| Compound Name | 2-(5,7,12,14-tetraoxo-13-pentan-3-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)butyl prop-2-enoate |
|---|---|
| PubChem CID | 118176349 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-(5,7,12,14-tetraoxo-13-pentan-3-yl-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(CC)N1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(C(CC)CC)C3=O |
| InChI | InChI=1S/C26H26N2O6/c1-5-14(6-2)27-23(30)16-9-11-18-22-19(12-10-17(21(16)22)24(27)31)26(33)28(25(18)32)15(7-3)13-34-20(29)8-4/h8-12,14-15H,4-7,13H2,1-3H3 |
| InChIKey | WCYVRGMZXBTBFA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|