C11H19NO2 — CID 54380739
2-(2,3-dimethylaziridin-1-yl)butyl prop-2-enoate (PubChem CID 54380739) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(2,3-dimethylaziridin-1-yl)butyl prop-2-enoate.
| Compound Name | 2-(2,3-dimethylaziridin-1-yl)butyl prop-2-enoate |
|---|---|
| PubChem CID | 54380739 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-(2,3-dimethylaziridin-1-yl)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(CC)N1C(C)C1C |
| InChI | InChI=1S/C11H19NO2/c1-5-10(7-14-11(13)6-2)12-8(3)9(12)4/h6,8-10H,2,5,7H2,1,3-4H3 |
| InChIKey | UZSFOGVYYLDWBT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|