C8H10BrNO3 — CID 163803650
3-bromo-2,6-dimethyl-4-nitrocyclohexa-2,4-dien-1-ol (PubChem CID 163803650) has the molecular formula C8H10BrNO3 and a molecular weight of 248.08 g/mol. Its IUPAC name is 3-bromo-2,6-dimethyl-4-nitrocyclohexa-2,4-dien-1-ol.
| Compound Name | 3-bromo-2,6-dimethyl-4-nitrocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 163803650 |
| Molecular Formula | C8H10BrNO3 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 3-bromo-2,6-dimethyl-4-nitrocyclohexa-2,4-dien-1-ol |
| SMILES | CC1=C(Br)C([N+](=O)[O-])=CC(C)C1O |
| InChI | InChI=1S/C8H10BrNO3/c1-4-3-6(10(12)13)7(9)5(2)8(4)11/h3-4,8,11H,1-2H3 |
| InChIKey | NHCYYXGCLHYSDR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|