C23H19N7O2S — CID 163804047
(3-benzamido-5-oxo-1-phenyl-4H-pyrazol-4-yl) N-diazenyl-N-phenylcarbamimidothioate (PubChem CID 163804047) has the molecular formula C23H19N7O2S and a molecular weight of 457.52 g/mol. Its IUPAC name is (3-benzamido-5-oxo-1-phenyl-4H-pyrazol-4-yl) N-diazenyl-N-phenylcarbamimidothioate.
| Compound Name | (3-benzamido-5-oxo-1-phenyl-4H-pyrazol-4-yl) N-diazenyl-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 163804047 |
| Molecular Formula | C23H19N7O2S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (3-benzamido-5-oxo-1-phenyl-4H-pyrazol-4-yl) N-diazenyl-N-phenylcarbamimidothioate |
| SMILES | [H]/N=N/N(/C(=N\[H])SC1C(=O)N(c2ccccc2)N=C1NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N7O2S/c24-23(30(28-25)18-14-8-3-9-15-18)33-19-20(26-21(31)16-10-4-1-5-11-16)27-29(22(19)32)17-12-6-2-7-13-17/h1-15,19,24-25H,(H,26,27,31)/b24-23+,28-25+ |
| InChIKey | NHLLBHSTQVFABW-SRWCXGDPSA-N |
| XLogP | 4.27 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|