C12H10N4O2S — CID 27059032
[(4S)-3-acetamido-5-oxo-1-phenyl-4H-pyrazol-4-yl] thiocyanate (PubChem CID 27059032) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is [(4S)-3-acetamido-5-oxo-1-phenyl-4H-pyrazol-4-yl] thiocyanate.
| Compound Name | [(4S)-3-acetamido-5-oxo-1-phenyl-4H-pyrazol-4-yl] thiocyanate |
|---|---|
| PubChem CID | 27059032 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | [(4S)-3-acetamido-5-oxo-1-phenyl-4H-pyrazol-4-yl] thiocyanate |
| SMILES | CC(=O)NC1=NN(c2ccccc2)C(=O)[C@H]1SC#N |
| InChI | InChI=1S/C12H10N4O2S/c1-8(17)14-11-10(19-7-13)12(18)16(15-11)9-5-3-2-4-6-9/h2-6,10H,1H3,(H,14,15,17)/t10-/m0/s1 |
| InChIKey | QBGWQFOZRRKVES-JTQLQIEISA-N |
| XLogP | 1.07 |
| TPSA | 85.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|