C14H14Cl3N3O2 — CID 98158170
N-[(1R)-2,2,2-trichloro-1-[(4R)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]ethyl]acetamide (PubChem CID 98158170) has the molecular formula C14H14Cl3N3O2 and a molecular weight of 362.64 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trichloro-1-[(4R)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]ethyl]acetamide.
| Compound Name | N-[(1R)-2,2,2-trichloro-1-[(4R)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 98158170 |
| Molecular Formula | C14H14Cl3N3O2 |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | N-[(1R)-2,2,2-trichloro-1-[(4R)-3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl]ethyl]acetamide |
| SMILES | CC(=O)N[C@H]([C@H]1C(=O)N(c2ccccc2)N=C1C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H14Cl3N3O2/c1-8-11(12(14(15,16)17)18-9(2)21)13(22)20(19-8)10-6-4-3-5-7-10/h3-7,11-12H,1-2H3,(H,18,21)/t11-,12+/m0/s1 |
| InChIKey | XUGLJOPWBSXNND-NWDGAFQWSA-N |
| XLogP | 2.90 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|