C12H22N4OU — CID 163806260
1-[2,2-diaminoethyl-[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]propan-2-ol;uranium(2+) (PubChem CID 163806260) has the molecular formula C12H22N4OU and a molecular weight of 476.36 g/mol. Its IUPAC name is 1-[2,2-diaminoethyl-[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]propan-2-ol;uranium(2+).
| Compound Name | 1-[2,2-diaminoethyl-[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]propan-2-ol;uranium(2+) |
|---|---|
| PubChem CID | 163806260 |
| Molecular Formula | C12H22N4OU |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 1-[2,2-diaminoethyl-[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]propan-2-ol;uranium(2+) |
| SMILES | CNC1=CCC(N(C[C-](N)N)C[C-](C)O)C=C1.[U+2] |
| InChI | InChI=1S/C12H22N4O.U/c1-9(17)7-16(8-12(13)14)11-5-3-10(15-2)4-6-11;/h3-5,11,15,17H,6-8,13-14H2,1-2H3;/q-2;+2 |
| InChIKey | FQYQGEOSCYUNLT-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|