C15H27N5O — CID 168968812
(2Z,4Z)-4,7,7-triamino-3-[(Z)-but-1-enyl]-6-piperazin-1-ylhepta-2,4,6-trien-2-ol (PubChem CID 168968812) has the molecular formula C15H27N5O and a molecular weight of 293.42 g/mol. Its IUPAC name is (2Z,4Z)-4,7,7-triamino-3-[(Z)-but-1-enyl]-6-piperazin-1-ylhepta-2,4,6-trien-2-ol.
| Compound Name | (2Z,4Z)-4,7,7-triamino-3-[(Z)-but-1-enyl]-6-piperazin-1-ylhepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 168968812 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | (2Z,4Z)-4,7,7-triamino-3-[(Z)-but-1-enyl]-6-piperazin-1-ylhepta-2,4,6-trien-2-ol |
| SMILES | CC/C=C\C(\C(N)=C\C(=C(N)N)N1CCNCC1)=C(/C)O |
| InChI | InChI=1S/C15H27N5O/c1-3-4-5-12(11(2)21)13(16)10-14(15(17)18)20-8-6-19-7-9-20/h4-5,10,19,21H,3,6-9,16-18H2,1-2H3/b5-4-,12-11-,13-10- |
| InChIKey | MQAVQKGPKDMORY-ORLPKTTFSA-N |
| XLogP | 0.62 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|