C14H23N5O — CID 168968776
2-[(1Z)-1,4,4-triamino-3-piperazin-1-ylbuta-1,3-dienyl]cyclohexa-1,3-dien-1-ol (PubChem CID 168968776) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is 2-[(1Z)-1,4,4-triamino-3-piperazin-1-ylbuta-1,3-dienyl]cyclohexa-1,3-dien-1-ol.
| Compound Name | 2-[(1Z)-1,4,4-triamino-3-piperazin-1-ylbuta-1,3-dienyl]cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 168968776 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 2-[(1Z)-1,4,4-triamino-3-piperazin-1-ylbuta-1,3-dienyl]cyclohexa-1,3-dien-1-ol |
| SMILES | NC(N)=C(/C=C(\N)C1=C(O)CCC=C1)N1CCNCC1 |
| InChI | InChI=1S/C14H23N5O/c15-11(10-3-1-2-4-13(10)20)9-12(14(16)17)19-7-5-18-6-8-19/h1,3,9,18,20H,2,4-8,15-17H2/b11-9- |
| InChIKey | UWHBEXDEVRNKOG-LUAWRHEFSA-N |
| XLogP | -0.02 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|