C12H20N2O — CID 143561889
(3Z,5Z)-4-piperazin-1-ylocta-3,5,7-trien-3-ol (PubChem CID 143561889) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (3Z,5Z)-4-piperazin-1-ylocta-3,5,7-trien-3-ol.
| Compound Name | (3Z,5Z)-4-piperazin-1-ylocta-3,5,7-trien-3-ol |
|---|---|
| PubChem CID | 143561889 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (3Z,5Z)-4-piperazin-1-ylocta-3,5,7-trien-3-ol |
| SMILES | C=C/C=C\C(=C(\O)CC)N1CCNCC1 |
| InChI | InChI=1S/C12H20N2O/c1-3-5-6-11(12(15)4-2)14-9-7-13-8-10-14/h3,5-6,13,15H,1,4,7-10H2,2H3/b6-5-,12-11- |
| InChIKey | DSALHAZKWLPHSQ-KSIKAEMPSA-N |
| XLogP | 1.81 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|