C12H24N4O — CID 163806261
1-[2,2-diaminoethyl-[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]propan-2-ol (PubChem CID 163806261) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-[2,2-diaminoethyl-[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]propan-2-ol.
| Compound Name | 1-[2,2-diaminoethyl-[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 163806261 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | 1-[2,2-diaminoethyl-[4-(methylamino)cyclohexa-2,4-dien-1-yl]amino]propan-2-ol |
| SMILES | CNC1=CCC(N(CC(N)N)CC(C)O)C=C1 |
| InChI | InChI=1S/C12H24N4O/c1-9(17)7-16(8-12(13)14)11-5-3-10(15-2)4-6-11/h3-5,9,11-12,15,17H,6-8,13-14H2,1-2H3 |
| InChIKey | QKAPDBNNTKEFCQ-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|