C23H32FNO4 — CID 163806284
2-[(4-ethylcyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-4-fluoro-5-hydroxybenzoic acid (PubChem CID 163806284) has the molecular formula C23H32FNO4 and a molecular weight of 405.51 g/mol. Its IUPAC name is 2-[(4-ethylcyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-4-fluoro-5-hydroxybenzoic acid.
| Compound Name | 2-[(4-ethylcyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-4-fluoro-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 163806284 |
| Molecular Formula | C23H32FNO4 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-[(4-ethylcyclohexyl)-(4-methylcyclohexanecarbonyl)amino]-4-fluoro-5-hydroxybenzoic acid |
| SMILES | CCC1CCC(N(C(=O)C2CCC(C)CC2)c2cc(F)c(O)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C23H32FNO4/c1-3-15-6-10-17(11-7-15)25(22(27)16-8-4-14(2)5-9-16)20-13-19(24)21(26)12-18(20)23(28)29/h12-17,26H,3-11H2,1-2H3,(H,28,29) |
| InChIKey | NJHYRKMOTVQIKP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |