About N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide
N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide (PubChem CID 163806450) has the molecular formula C17H17F2N3O2
and a molecular weight of 333.34 g/mol. Its IUPAC name is N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide |
| PubChem CID | 163806450 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide |
| SMILES | C=C(CC(=O)CCNC(=O)c1ccn[nH]1)c1c(C)cc(F)cc1F |
| InChI | InChI=1S/C17H17F2N3O2/c1-10-7-12(18)9-14(19)16(10)11(2)8-13(23)3-5-20-17(24)15-4-6-21-22-15/h4,6-7,9H,2-3,5,8H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | NJLFHJJCLJSYQX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide?
The IUPAC name of N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide (CID 163806450) is N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide.
What is the SMILES notation for N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide?
The canonical SMILES for N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide is C=C(CC(=O)CCNC(=O)c1ccn[nH]1)c1c(C)cc(F)cc1F.
What is the InChIKey of N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide?
The InChIKey is NJLFHJJCLJSYQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N3O2/c1-10-7-12(18)9-14(19)16(10)11(2)8-13(23)3-5-20-17(24)15-4-6-21-22-15/h4,6-7,9H,2-3,5,8H2,1H3,(H,20,24)(H,21,22).
What are the key properties of N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide?
N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide has a molecular weight of 333.34 g/mol, XLogP of 2.79, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,4-difluoro-6-methylphenyl)-3-oxohex-5-enyl]-1H-pyrazole-5-carboxamide is sourced from PubChem (CID 163806450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).