C18H25FNO+ — CID 163806951
9-fluoro-2-methoxy-5,6,6,7-tetramethyl-1,2,7,11b-tetrahydrobenzo[a]quinolizin-5-ium (PubChem CID 163806951) has the molecular formula C18H25FNO+ and a molecular weight of 290.40 g/mol. Its IUPAC name is 9-fluoro-2-methoxy-5,6,6,7-tetramethyl-1,2,7,11b-tetrahydrobenzo[a]quinolizin-5-ium.
| Compound Name | 9-fluoro-2-methoxy-5,6,6,7-tetramethyl-1,2,7,11b-tetrahydrobenzo[a]quinolizin-5-ium |
|---|---|
| PubChem CID | 163806951 |
| Molecular Formula | C18H25FNO+ |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 9-fluoro-2-methoxy-5,6,6,7-tetramethyl-1,2,7,11b-tetrahydrobenzo[a]quinolizin-5-ium |
| SMILES | COC1C=C[N+]2(C)C(C1)c1ccc(F)cc1C(C)C2(C)C |
| InChI | InChI=1S/C18H25FNO/c1-12-16-10-13(19)6-7-15(16)17-11-14(21-5)8-9-20(17,4)18(12,2)3/h6-10,12,14,17H,11H2,1-5H3/q+1 |
| InChIKey | VYGWFUSMKQGSIR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|